About 1-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone
1-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone (PubChem CID 2746593) has the molecular formula C13H14ClN3OS
and a molecular weight of 295.79 g/mol. Its IUPAC name is 1-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone |
| PubChem CID | 2746593 |
| Molecular Formula | C13H14ClN3OS |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 1-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2nc3ccc(Cl)cc3s2)CC1 |
| InChI | InChI=1S/C13H14ClN3OS/c1-9(18)16-4-6-17(7-5-16)13-15-11-3-2-10(14)8-12(11)19-13/h2-3,8H,4-7H2,1H3 |
| InChIKey | QPOAUYITWSGNTD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone?
The IUPAC name of 1-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone (CID 2746593) is 1-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone.
What is the SMILES notation for 1-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone?
The canonical SMILES for 1-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone is CC(=O)N1CCN(c2nc3ccc(Cl)cc3s2)CC1.
What is the InChIKey of 1-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone?
The InChIKey is QPOAUYITWSGNTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClN3OS/c1-9(18)16-4-6-17(7-5-16)13-15-11-3-2-10(14)8-12(11)19-13/h2-3,8H,4-7H2,1H3.
What are the key properties of 1-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone?
1-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone has a molecular weight of 295.79 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(6-chloro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethanone is sourced from PubChem (CID 2746593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).