About [[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-methylbenzoate
[[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-methylbenzoate (PubChem CID 2746717) has the molecular formula C20H15Cl2N3O3
and a molecular weight of 416.26 g/mol. Its IUPAC name is [[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-methylbenzoate.
Molecular Properties
| Compound Name | [[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-methylbenzoate |
| PubChem CID | 2746717 |
| Molecular Formula | C20H15Cl2N3O3 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | [[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)ON=C(N)c2ccc(Oc3c(Cl)cncc3Cl)cc2)cc1 |
| InChI | InChI=1S/C20H15Cl2N3O3/c1-12-2-4-14(5-3-12)20(26)28-25-19(23)13-6-8-15(9-7-13)27-18-16(21)10-24-11-17(18)22/h2-11H,1H3,(H2,23,25) |
| InChIKey | PFGUYFXATFBWLH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-methylbenzoate?
The IUPAC name of [[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-methylbenzoate (CID 2746717) is [[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-methylbenzoate.
What is the SMILES notation for [[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-methylbenzoate?
The canonical SMILES for [[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-methylbenzoate is Cc1ccc(C(=O)ON=C(N)c2ccc(Oc3c(Cl)cncc3Cl)cc2)cc1.
What is the InChIKey of [[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-methylbenzoate?
The InChIKey is PFGUYFXATFBWLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15Cl2N3O3/c1-12-2-4-14(5-3-12)20(26)28-25-19(23)13-6-8-15(9-7-13)27-18-16(21)10-24-11-17(18)22/h2-11H,1H3,(H2,23,25).
What are the key properties of [[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-methylbenzoate?
[[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-methylbenzoate has a molecular weight of 416.26 g/mol, XLogP of 4.97, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[amino-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]methylidene]amino] 4-methylbenzoate is sourced from PubChem (CID 2746717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).