About 2-methylsulfanyl-4,6-bis(phenylsulfanyl)pyrimidine-5-carbonitrile
2-methylsulfanyl-4,6-bis(phenylsulfanyl)pyrimidine-5-carbonitrile (PubChem CID 2746988) has the molecular formula C18H13N3S3
and a molecular weight of 367.52 g/mol. Its IUPAC name is 2-methylsulfanyl-4,6-bis(phenylsulfanyl)pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 2-methylsulfanyl-4,6-bis(phenylsulfanyl)pyrimidine-5-carbonitrile |
| PubChem CID | 2746988 |
| Molecular Formula | C18H13N3S3 |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 2-methylsulfanyl-4,6-bis(phenylsulfanyl)pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(Sc2ccccc2)c(C#N)c(Sc2ccccc2)n1 |
| InChI | InChI=1S/C18H13N3S3/c1-22-18-20-16(23-13-8-4-2-5-9-13)15(12-19)17(21-18)24-14-10-6-3-7-11-14/h2-11H,1H3 |
| InChIKey | KURAURJHPIYXMW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methylsulfanyl-4,6-bis(phenylsulfanyl)pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-4,6-bis(phenylsulfanyl)pyrimidine-5-carbonitrile?
The IUPAC name of 2-methylsulfanyl-4,6-bis(phenylsulfanyl)pyrimidine-5-carbonitrile (CID 2746988) is 2-methylsulfanyl-4,6-bis(phenylsulfanyl)pyrimidine-5-carbonitrile.
What is the SMILES notation for 2-methylsulfanyl-4,6-bis(phenylsulfanyl)pyrimidine-5-carbonitrile?
The canonical SMILES for 2-methylsulfanyl-4,6-bis(phenylsulfanyl)pyrimidine-5-carbonitrile is CSc1nc(Sc2ccccc2)c(C#N)c(Sc2ccccc2)n1.
What is the InChIKey of 2-methylsulfanyl-4,6-bis(phenylsulfanyl)pyrimidine-5-carbonitrile?
The InChIKey is KURAURJHPIYXMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3S3/c1-22-18-20-16(23-13-8-4-2-5-9-13)15(12-19)17(21-18)24-14-10-6-3-7-11-14/h2-11H,1H3.
What are the key properties of 2-methylsulfanyl-4,6-bis(phenylsulfanyl)pyrimidine-5-carbonitrile?
2-methylsulfanyl-4,6-bis(phenylsulfanyl)pyrimidine-5-carbonitrile has a molecular weight of 367.52 g/mol, XLogP of 5.37, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-4,6-bis(phenylsulfanyl)pyrimidine-5-carbonitrile is sourced from PubChem (CID 2746988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).