About 1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol
1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol (PubChem CID 2747081) has the molecular formula C16H12F2N4O2
and a molecular weight of 330.29 g/mol. Its IUPAC name is 1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol.
Molecular Properties
| Compound Name | 1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol |
| PubChem CID | 2747081 |
| Molecular Formula | C16H12F2N4O2 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol |
| SMILES | OC(c1nc2ccc(F)cc2[nH]1)C(O)c1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C16H12F2N4O2/c17-7-1-3-9-11(5-7)21-15(19-9)13(23)14(24)16-20-10-4-2-8(18)6-12(10)22-16/h1-6,13-14,23-24H,(H,19,21)(H,20,22) |
| InChIKey | GATVUWZGDBORAV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol?
The IUPAC name of 1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol (CID 2747081) is 1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol.
What is the SMILES notation for 1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol?
The canonical SMILES for 1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol is OC(c1nc2ccc(F)cc2[nH]1)C(O)c1nc2ccc(F)cc2[nH]1.
What is the InChIKey of 1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol?
The InChIKey is GATVUWZGDBORAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F2N4O2/c17-7-1-3-9-11(5-7)21-15(19-9)13(23)14(24)16-20-10-4-2-8(18)6-12(10)22-16/h1-6,13-14,23-24H,(H,19,21)(H,20,22).
What are the key properties of 1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol?
1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol has a molecular weight of 330.29 g/mol, XLogP of 2.48, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(6-fluoro-1H-benzimidazol-2-yl)ethane-1,2-diol is sourced from PubChem (CID 2747081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).