About 3-(2,6-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)-5-methyl-1,2-oxazole-4-carboxamide
3-(2,6-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 2747401) has the molecular formula C17H13Cl2N3O3
and a molecular weight of 378.22 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)-5-methyl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-(2,6-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)-5-methyl-1,2-oxazole-4-carboxamide |
| PubChem CID | 2747401 |
| Molecular Formula | C17H13Cl2N3O3 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2c(-c3c(Cl)cccc3Cl)noc2C)cn1 |
| InChI | InChI=1S/C17H13Cl2N3O3/c1-9-14(17(23)21-10-6-7-13(24-2)20-8-10)16(22-25-9)15-11(18)4-3-5-12(15)19/h3-8H,1-2H3,(H,21,23) |
| InChIKey | SWMNJRMVQMKVAO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2,6-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)-5-methyl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)-5-methyl-1,2-oxazole-4-carboxamide?
The IUPAC name of 3-(2,6-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)-5-methyl-1,2-oxazole-4-carboxamide (CID 2747401) is 3-(2,6-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)-5-methyl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for 3-(2,6-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)-5-methyl-1,2-oxazole-4-carboxamide?
The canonical SMILES for 3-(2,6-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)-5-methyl-1,2-oxazole-4-carboxamide is COc1ccc(NC(=O)c2c(-c3c(Cl)cccc3Cl)noc2C)cn1.
What is the InChIKey of 3-(2,6-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)-5-methyl-1,2-oxazole-4-carboxamide?
The InChIKey is SWMNJRMVQMKVAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13Cl2N3O3/c1-9-14(17(23)21-10-6-7-13(24-2)20-8-10)16(22-25-9)15-11(18)4-3-5-12(15)19/h3-8H,1-2H3,(H,21,23).
What are the key properties of 3-(2,6-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)-5-methyl-1,2-oxazole-4-carboxamide?
3-(2,6-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)-5-methyl-1,2-oxazole-4-carboxamide has a molecular weight of 378.22 g/mol, XLogP of 4.61, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dichlorophenyl)-N-(6-methoxy-3-pyridinyl)-5-methyl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 2747401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).