C7H8N4OS — CID 2747504
5-(1,5-dimethylpyrazol-3-yl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 2747504) has the molecular formula C7H8N4OS and a molecular weight of 196.23 g/mol. Its IUPAC name is 5-(1,5-dimethylpyrazol-3-yl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(1,5-dimethylpyrazol-3-yl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 2747504 |
| Molecular Formula | C7H8N4OS |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 5-(1,5-dimethylpyrazol-3-yl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | Cc1cc(-c2n[nH]c(=S)o2)nn1C |
| InChI | InChI=1S/C7H8N4OS/c1-4-3-5(10-11(4)2)6-8-9-7(13)12-6/h3H,1-2H3,(H,9,13) |
| InChIKey | FNLPVNYSARWYOQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|