About N-butyl-[1,3]thiazolo[5,4-b]pyridin-2-amine
N-butyl-[1,3]thiazolo[5,4-b]pyridin-2-amine (PubChem CID 2747541) has the molecular formula C10H13N3S
and a molecular weight of 207.30 g/mol. Its IUPAC name is N-butyl-[1,3]thiazolo[5,4-b]pyridin-2-amine.
Molecular Properties
| Compound Name | N-butyl-[1,3]thiazolo[5,4-b]pyridin-2-amine |
| PubChem CID | 2747541 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | N-butyl-[1,3]thiazolo[5,4-b]pyridin-2-amine |
| SMILES | CCCCNc1nc2cccnc2s1 |
| InChI | InChI=1S/C10H13N3S/c1-2-3-6-12-10-13-8-5-4-7-11-9(8)14-10/h4-5,7H,2-3,6H2,1H3,(H,12,13) |
| InChIKey | CAISUURRTUXNQZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-[1,3]thiazolo[5,4-b]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-[1,3]thiazolo[5,4-b]pyridin-2-amine?
The IUPAC name of N-butyl-[1,3]thiazolo[5,4-b]pyridin-2-amine (CID 2747541) is N-butyl-[1,3]thiazolo[5,4-b]pyridin-2-amine.
What is the SMILES notation for N-butyl-[1,3]thiazolo[5,4-b]pyridin-2-amine?
The canonical SMILES for N-butyl-[1,3]thiazolo[5,4-b]pyridin-2-amine is CCCCNc1nc2cccnc2s1.
What is the InChIKey of N-butyl-[1,3]thiazolo[5,4-b]pyridin-2-amine?
The InChIKey is CAISUURRTUXNQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3S/c1-2-3-6-12-10-13-8-5-4-7-11-9(8)14-10/h4-5,7H,2-3,6H2,1H3,(H,12,13).
What are the key properties of N-butyl-[1,3]thiazolo[5,4-b]pyridin-2-amine?
N-butyl-[1,3]thiazolo[5,4-b]pyridin-2-amine has a molecular weight of 207.30 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-[1,3]thiazolo[5,4-b]pyridin-2-amine is sourced from PubChem (CID 2747541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).