C15H19NO2S3 — CID 2747652
2-(4-cyclohexylsulfanyl-3-nitrophenyl)-1,3-dithiolane (PubChem CID 2747652) has the molecular formula C15H19NO2S3 and a molecular weight of 341.52 g/mol. Its IUPAC name is 2-(4-cyclohexylsulfanyl-3-nitrophenyl)-1,3-dithiolane.
| Compound Name | 2-(4-cyclohexylsulfanyl-3-nitrophenyl)-1,3-dithiolane |
|---|---|
| PubChem CID | 2747652 |
| Molecular Formula | C15H19NO2S3 |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 2-(4-cyclohexylsulfanyl-3-nitrophenyl)-1,3-dithiolane |
| SMILES | O=[N+]([O-])c1cc(C2SCCS2)ccc1SC1CCCCC1 |
| InChI | InChI=1S/C15H19NO2S3/c17-16(18)13-10-11(15-19-8-9-20-15)6-7-14(13)21-12-4-2-1-3-5-12/h6-7,10,12,15H,1-5,8-9H2 |
| InChIKey | BVIOTZWYNOEKAT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|