About di(pyrrol-1-yl)methanone
di(pyrrol-1-yl)methanone (PubChem CID 27478) has the molecular formula C9H8N2O
and a molecular weight of 160.18 g/mol. Its IUPAC name is di(pyrrol-1-yl)methanone.
Molecular Properties
| Compound Name | di(pyrrol-1-yl)methanone |
| PubChem CID | 27478 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | di(pyrrol-1-yl)methanone |
| SMILES | O=C(n1cccc1)n1cccc1 |
| InChI | InChI=1S/C9H8N2O/c12-9(10-5-1-2-6-10)11-7-3-4-8-11/h1-8H |
| InChIKey | AVDNGGJZZVTQNA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze di(pyrrol-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(pyrrol-1-yl)methanone?
The IUPAC name of di(pyrrol-1-yl)methanone (CID 27478) is di(pyrrol-1-yl)methanone.
What is the SMILES notation for di(pyrrol-1-yl)methanone?
The canonical SMILES for di(pyrrol-1-yl)methanone is O=C(n1cccc1)n1cccc1.
What is the InChIKey of di(pyrrol-1-yl)methanone?
The InChIKey is AVDNGGJZZVTQNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O/c12-9(10-5-1-2-6-10)11-7-3-4-8-11/h1-8H.
What are the key properties of di(pyrrol-1-yl)methanone?
di(pyrrol-1-yl)methanone has a molecular weight of 160.18 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for di(pyrrol-1-yl)methanone is sourced from PubChem (CID 27478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).