C22H23ClN6O — CID 27478215
1-(3-chlorophenyl)-3-[4-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]phenyl]urea (PubChem CID 27478215) has the molecular formula C22H23ClN6O and a molecular weight of 422.92 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[4-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]phenyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[4-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]phenyl]urea |
|---|---|
| PubChem CID | 27478215 |
| Molecular Formula | C22H23ClN6O |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[4-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]phenyl]urea |
| SMILES | Cc1cc(N2CCCC2)nc(Nc2ccc(NC(=O)Nc3cccc(Cl)c3)cc2)n1 |
| InChI | InChI=1S/C22H23ClN6O/c1-15-13-20(29-11-2-3-12-29)28-21(24-15)25-17-7-9-18(10-8-17)26-22(30)27-19-6-4-5-16(23)14-19/h4-10,13-14H,2-3,11-12H2,1H3,(H,24,25,28)(H2,26,27,30) |
| InChIKey | NYYMQIKUCYLUTL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |