About thianthrene-2,3,7,8-tetrol
thianthrene-2,3,7,8-tetrol (PubChem CID 2748003) has the molecular formula C12H8O4S2
and a molecular weight of 280.33 g/mol. Its IUPAC name is thianthrene-2,3,7,8-tetrol.
Molecular Properties
| Compound Name | thianthrene-2,3,7,8-tetrol |
| PubChem CID | 2748003 |
| Molecular Formula | C12H8O4S2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | thianthrene-2,3,7,8-tetrol |
| SMILES | Oc1cc2c(cc1O)Sc1cc(O)c(O)cc1S2 |
| InChI | InChI=1S/C12H8O4S2/c13-5-1-9-10(2-6(5)14)18-12-4-8(16)7(15)3-11(12)17-9/h1-4,13-16H |
| InChIKey | KPWWYSXDMXFVIW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze thianthrene-2,3,7,8-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thianthrene-2,3,7,8-tetrol?
The IUPAC name of thianthrene-2,3,7,8-tetrol (CID 2748003) is thianthrene-2,3,7,8-tetrol.
What is the SMILES notation for thianthrene-2,3,7,8-tetrol?
The canonical SMILES for thianthrene-2,3,7,8-tetrol is Oc1cc2c(cc1O)Sc1cc(O)c(O)cc1S2.
What is the InChIKey of thianthrene-2,3,7,8-tetrol?
The InChIKey is KPWWYSXDMXFVIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O4S2/c13-5-1-9-10(2-6(5)14)18-12-4-8(16)7(15)3-11(12)17-9/h1-4,13-16H.
What are the key properties of thianthrene-2,3,7,8-tetrol?
thianthrene-2,3,7,8-tetrol has a molecular weight of 280.33 g/mol, XLogP of 3.12, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for thianthrene-2,3,7,8-tetrol is sourced from PubChem (CID 2748003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).