C12H14Br4O2 — CID 2748010
1,2,4,5-tetrakis(bromomethyl)-3,6-dimethoxybenzene (PubChem CID 2748010) has the molecular formula C12H14Br4O2 and a molecular weight of 509.86 g/mol. Its IUPAC name is 1,2,4,5-tetrakis(bromomethyl)-3,6-dimethoxybenzene.
| Compound Name | 1,2,4,5-tetrakis(bromomethyl)-3,6-dimethoxybenzene |
|---|---|
| PubChem CID | 2748010 |
| Molecular Formula | C12H14Br4O2 |
| Molecular Weight | 509.86 g/mol |
| Exact Mass | 505.77 |
| IUPAC Name | 1,2,4,5-tetrakis(bromomethyl)-3,6-dimethoxybenzene |
| SMILES | COc1c(CBr)c(CBr)c(OC)c(CBr)c1CBr |
| InChI | InChI=1S/C12H14Br4O2/c1-17-11-7(3-13)9(5-15)12(18-2)10(6-16)8(11)4-14/h3-6H2,1-2H3 |
| InChIKey | HBRRNLRZHZIJBQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.86 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|