C23H14Cl4N6O6 — CID 2748079
methyl 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]-5-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]-3-methoxycarbonylphenyl]methyl]benzoate (PubChem CID 2748079) has the molecular formula C23H14Cl4N6O6 and a molecular weight of 612.21 g/mol. Its IUPAC name is methyl 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]-5-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]-3-methoxycarbonylphenyl]methyl]benzoate.
| Compound Name | methyl 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]-5-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]-3-methoxycarbonylphenyl]methyl]benzoate |
|---|---|
| PubChem CID | 2748079 |
| Molecular Formula | C23H14Cl4N6O6 |
| Molecular Weight | 612.21 g/mol |
| Exact Mass | 609.97 |
| IUPAC Name | methyl 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]-5-[[4-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]-3-methoxycarbonylphenyl]methyl]benzoate |
| SMILES | COC(=O)c1cc(Cc2ccc(Oc3nc(Cl)nc(Cl)n3)c(C(=O)OC)c2)ccc1Oc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C23H14Cl4N6O6/c1-36-16(34)12-8-10(3-5-14(12)38-22-30-18(24)28-19(25)31-22)7-11-4-6-15(13(9-11)17(35)37-2)39-23-32-20(26)29-21(27)33-23/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | YVOHGWXDKOFSEQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 148.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.21 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |