About 1,1-diphenylpropane-1,2-diol
1,1-diphenylpropane-1,2-diol (PubChem CID 2748265) has the molecular formula C15H16O2
and a molecular weight of 228.29 g/mol. Its IUPAC name is 1,1-diphenylpropane-1,2-diol.
Molecular Properties
| Compound Name | 1,1-diphenylpropane-1,2-diol |
| PubChem CID | 2748265 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 1,1-diphenylpropane-1,2-diol |
| SMILES | CC(O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H16O2/c1-12(16)15(17,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,16-17H,1H3 |
| InChIKey | RQKXFLUAQLDHMO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1-diphenylpropane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diphenylpropane-1,2-diol?
The IUPAC name of 1,1-diphenylpropane-1,2-diol (CID 2748265) is 1,1-diphenylpropane-1,2-diol.
What is the SMILES notation for 1,1-diphenylpropane-1,2-diol?
The canonical SMILES for 1,1-diphenylpropane-1,2-diol is CC(O)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 1,1-diphenylpropane-1,2-diol?
The InChIKey is RQKXFLUAQLDHMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2/c1-12(16)15(17,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,16-17H,1H3.
What are the key properties of 1,1-diphenylpropane-1,2-diol?
1,1-diphenylpropane-1,2-diol has a molecular weight of 228.29 g/mol, XLogP of 2.30, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diphenylpropane-1,2-diol is sourced from PubChem (CID 2748265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).