C14H14N2O3S — CID 2748702
1-(4-acetyl-5-methyl-1,3-oxathiol-2-ylidene)-3-benzylurea (PubChem CID 2748702) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is 1-(4-acetyl-5-methyl-1,3-oxathiol-2-ylidene)-3-benzylurea.
| Compound Name | 1-(4-acetyl-5-methyl-1,3-oxathiol-2-ylidene)-3-benzylurea |
|---|---|
| PubChem CID | 2748702 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 1-(4-acetyl-5-methyl-1,3-oxathiol-2-ylidene)-3-benzylurea |
| SMILES | CC(=O)c1sc(=NC(=O)NCc2ccccc2)oc1C |
| InChI | InChI=1S/C14H14N2O3S/c1-9(17)12-10(2)19-14(20-12)16-13(18)15-8-11-6-4-3-5-7-11/h3-7H,8H2,1-2H3,(H,15,18) |
| InChIKey | MHVAZGGWKWCHKG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |