About 2-phenyl-1,3-thiazol-4-one
2-phenyl-1,3-thiazol-4-one (PubChem CID 2748720) has the molecular formula C9H7NOS
and a molecular weight of 177.23 g/mol. Its IUPAC name is 2-phenyl-1,3-thiazol-4-one.
Molecular Properties
| Compound Name | 2-phenyl-1,3-thiazol-4-one |
| PubChem CID | 2748720 |
| Molecular Formula | C9H7NOS |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.02 |
| IUPAC Name | 2-phenyl-1,3-thiazol-4-one |
| SMILES | O=C1CSC(c2ccccc2)=N1 |
| InChI | InChI=1S/C9H7NOS/c11-8-6-12-9(10-8)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | LFLIZASYILFMIO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-1,3-thiazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1,3-thiazol-4-one?
The IUPAC name of 2-phenyl-1,3-thiazol-4-one (CID 2748720) is 2-phenyl-1,3-thiazol-4-one.
What is the SMILES notation for 2-phenyl-1,3-thiazol-4-one?
The canonical SMILES for 2-phenyl-1,3-thiazol-4-one is O=C1CSC(c2ccccc2)=N1.
What is the InChIKey of 2-phenyl-1,3-thiazol-4-one?
The InChIKey is LFLIZASYILFMIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NOS/c11-8-6-12-9(10-8)7-4-2-1-3-5-7/h1-5H,6H2.
What are the key properties of 2-phenyl-1,3-thiazol-4-one?
2-phenyl-1,3-thiazol-4-one has a molecular weight of 177.23 g/mol, XLogP of 1.71, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1,3-thiazol-4-one is sourced from PubChem (CID 2748720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).