About 1-(2,6-dimethyl-7H-pyrrolo[3,2-f]indol-1-yl)ethanone
1-(2,6-dimethyl-7H-pyrrolo[3,2-f]indol-1-yl)ethanone (PubChem CID 2748906) has the molecular formula C14H14N2O
and a molecular weight of 226.28 g/mol. Its IUPAC name is 1-(2,6-dimethyl-7H-pyrrolo[3,2-f]indol-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2,6-dimethyl-7H-pyrrolo[3,2-f]indol-1-yl)ethanone |
| PubChem CID | 2748906 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 1-(2,6-dimethyl-7H-pyrrolo[3,2-f]indol-1-yl)ethanone |
| SMILES | CC(=O)n1c(C)cc2cc3cc(C)[nH]c3cc21 |
| InChI | InChI=1S/C14H14N2O/c1-8-4-11-6-12-5-9(2)16(10(3)17)14(12)7-13(11)15-8/h4-7,15H,1-3H3 |
| InChIKey | UIICRSLSYSVMCM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,6-dimethyl-7H-pyrrolo[3,2-f]indol-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dimethyl-7H-pyrrolo[3,2-f]indol-1-yl)ethanone?
The IUPAC name of 1-(2,6-dimethyl-7H-pyrrolo[3,2-f]indol-1-yl)ethanone (CID 2748906) is 1-(2,6-dimethyl-7H-pyrrolo[3,2-f]indol-1-yl)ethanone.
What is the SMILES notation for 1-(2,6-dimethyl-7H-pyrrolo[3,2-f]indol-1-yl)ethanone?
The canonical SMILES for 1-(2,6-dimethyl-7H-pyrrolo[3,2-f]indol-1-yl)ethanone is CC(=O)n1c(C)cc2cc3cc(C)[nH]c3cc21.
What is the InChIKey of 1-(2,6-dimethyl-7H-pyrrolo[3,2-f]indol-1-yl)ethanone?
The InChIKey is UIICRSLSYSVMCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O/c1-8-4-11-6-12-5-9(2)16(10(3)17)14(12)7-13(11)15-8/h4-7,15H,1-3H3.
What are the key properties of 1-(2,6-dimethyl-7H-pyrrolo[3,2-f]indol-1-yl)ethanone?
1-(2,6-dimethyl-7H-pyrrolo[3,2-f]indol-1-yl)ethanone has a molecular weight of 226.28 g/mol, XLogP of 3.40, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dimethyl-7H-pyrrolo[3,2-f]indol-1-yl)ethanone is sourced from PubChem (CID 2748906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).