About N-[9,10-dioxo-2-[(phenylhydrazinylidene)methyl]anthracen-1-yl]acetamide
N-[9,10-dioxo-2-[(phenylhydrazinylidene)methyl]anthracen-1-yl]acetamide (PubChem CID 2749316) has the molecular formula C23H17N3O3
and a molecular weight of 383.41 g/mol. Its IUPAC name is N-[9,10-dioxo-2-[(phenylhydrazinylidene)methyl]anthracen-1-yl]acetamide.
Molecular Properties
| Compound Name | N-[9,10-dioxo-2-[(phenylhydrazinylidene)methyl]anthracen-1-yl]acetamide |
| PubChem CID | 2749316 |
| Molecular Formula | C23H17N3O3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-[9,10-dioxo-2-[(phenylhydrazinylidene)methyl]anthracen-1-yl]acetamide |
| SMILES | CC(=O)Nc1c(C=NNc2ccccc2)ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H17N3O3/c1-14(27)25-21-15(13-24-26-16-7-3-2-4-8-16)11-12-19-20(21)23(29)18-10-6-5-9-17(18)22(19)28/h2-13,26H,1H3,(H,25,27) |
| InChIKey | DUIOSZKRZJESHQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[9,10-dioxo-2-[(phenylhydrazinylidene)methyl]anthracen-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[9,10-dioxo-2-[(phenylhydrazinylidene)methyl]anthracen-1-yl]acetamide?
The IUPAC name of N-[9,10-dioxo-2-[(phenylhydrazinylidene)methyl]anthracen-1-yl]acetamide (CID 2749316) is N-[9,10-dioxo-2-[(phenylhydrazinylidene)methyl]anthracen-1-yl]acetamide.
What is the SMILES notation for N-[9,10-dioxo-2-[(phenylhydrazinylidene)methyl]anthracen-1-yl]acetamide?
The canonical SMILES for N-[9,10-dioxo-2-[(phenylhydrazinylidene)methyl]anthracen-1-yl]acetamide is CC(=O)Nc1c(C=NNc2ccccc2)ccc2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of N-[9,10-dioxo-2-[(phenylhydrazinylidene)methyl]anthracen-1-yl]acetamide?
The InChIKey is DUIOSZKRZJESHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N3O3/c1-14(27)25-21-15(13-24-26-16-7-3-2-4-8-16)11-12-19-20(21)23(29)18-10-6-5-9-17(18)22(19)28/h2-13,26H,1H3,(H,25,27).
What are the key properties of N-[9,10-dioxo-2-[(phenylhydrazinylidene)methyl]anthracen-1-yl]acetamide?
N-[9,10-dioxo-2-[(phenylhydrazinylidene)methyl]anthracen-1-yl]acetamide has a molecular weight of 383.41 g/mol, XLogP of 3.87, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[9,10-dioxo-2-[(phenylhydrazinylidene)methyl]anthracen-1-yl]acetamide is sourced from PubChem (CID 2749316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).