C21H15NO6 — CID 2749331
ethyl 3-acetyl-1,6,11-trioxo-2H-naphtho[2,3-e]indole-2-carboxylate (PubChem CID 2749331) has the molecular formula C21H15NO6 and a molecular weight of 377.35 g/mol. Its IUPAC name is ethyl 3-acetyl-1,6,11-trioxo-2H-naphtho[2,3-e]indole-2-carboxylate.
| Compound Name | ethyl 3-acetyl-1,6,11-trioxo-2H-naphtho[2,3-e]indole-2-carboxylate |
|---|---|
| PubChem CID | 2749331 |
| Molecular Formula | C21H15NO6 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | ethyl 3-acetyl-1,6,11-trioxo-2H-naphtho[2,3-e]indole-2-carboxylate |
| SMILES | CCOC(=O)C1C(=O)c2c(ccc3c2C(=O)c2ccccc2C3=O)N1C(C)=O |
| InChI | InChI=1S/C21H15NO6/c1-3-28-21(27)17-20(26)16-14(22(17)10(2)23)9-8-13-15(16)19(25)12-7-5-4-6-11(12)18(13)24/h4-9,17H,3H2,1-2H3 |
| InChIKey | JZEWSRKCCZNWLH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|