C18H24N2O6 — CID 2749627
ethyl 2-[2,4-diacetamido-5-(2-ethoxy-2-oxoethyl)phenyl]acetate (PubChem CID 2749627) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is ethyl 2-[2,4-diacetamido-5-(2-ethoxy-2-oxoethyl)phenyl]acetate.
| Compound Name | ethyl 2-[2,4-diacetamido-5-(2-ethoxy-2-oxoethyl)phenyl]acetate |
|---|---|
| PubChem CID | 2749627 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | ethyl 2-[2,4-diacetamido-5-(2-ethoxy-2-oxoethyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(CC(=O)OCC)c(NC(C)=O)cc1NC(C)=O |
| InChI | InChI=1S/C18H24N2O6/c1-5-25-17(23)8-13-7-14(9-18(24)26-6-2)16(20-12(4)22)10-15(13)19-11(3)21/h7,10H,5-6,8-9H2,1-4H3,(H,19,21)(H,20,22) |
| InChIKey | ZDQCXOFAKKMQSQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |