C14H12N2O4 — CID 2749631
1,7-diacetyl-3,5-dihydropyrrolo[3,2-f]indole-2,6-dione (PubChem CID 2749631) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 1,7-diacetyl-3,5-dihydropyrrolo[3,2-f]indole-2,6-dione.
| Compound Name | 1,7-diacetyl-3,5-dihydropyrrolo[3,2-f]indole-2,6-dione |
|---|---|
| PubChem CID | 2749631 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1,7-diacetyl-3,5-dihydropyrrolo[3,2-f]indole-2,6-dione |
| SMILES | CC(=O)N1C(=O)Cc2cc3c(cc21)N(C(C)=O)C(=O)C3 |
| InChI | InChI=1S/C14H12N2O4/c1-7(17)15-11-6-12-10(3-9(11)4-13(15)19)5-14(20)16(12)8(2)18/h3,6H,4-5H2,1-2H3 |
| InChIKey | ZWASCRGDWZGHNI-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |