About trimethyl-[(Z)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]azanium chloride
trimethyl-[(Z)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]azanium chloride (PubChem CID 2750116) has the molecular formula C14H24ClNO
and a molecular weight of 257.80 g/mol. Its IUPAC name is trimethyl-[(Z)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]azanium chloride.
Molecular Properties
| Compound Name | trimethyl-[(Z)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]azanium chloride |
| PubChem CID | 2750116 |
| Molecular Formula | C14H24ClNO |
| Molecular Weight | 257.80 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | trimethyl-[(Z)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]azanium chloride |
| SMILES | CC12CCC(/C(=C/[N+](C)(C)C)C1=O)C2(C)C.[Cl-] |
| InChI | InChI=1S/C14H24NO.ClH/c1-13(2)11-7-8-14(13,3)12(16)10(11)9-15(4,5)6;/h9,11H,7-8H2,1-6H3;1H/q+1;/p-1/b10-9-; |
| InChIKey | AKBSZVKYAQFSFM-KVVVOXFISA-M |
| XLogP | -0.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.80 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(Z)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(Z)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]azanium chloride?
The IUPAC name of trimethyl-[(Z)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]azanium chloride (CID 2750116) is trimethyl-[(Z)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]azanium chloride.
What is the SMILES notation for trimethyl-[(Z)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]azanium chloride?
The canonical SMILES for trimethyl-[(Z)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]azanium chloride is CC12CCC(/C(=C/[N+](C)(C)C)C1=O)C2(C)C.[Cl-].
What is the InChIKey of trimethyl-[(Z)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]azanium chloride?
The InChIKey is AKBSZVKYAQFSFM-KVVVOXFISA-M. The full InChI is InChI=1S/C14H24NO.ClH/c1-13(2)11-7-8-14(13,3)12(16)10(11)9-15(4,5)6;/h9,11H,7-8H2,1-6H3;1H/q+1;/p-1/b10-9-;.
What are the key properties of trimethyl-[(Z)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]azanium chloride?
trimethyl-[(Z)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]azanium chloride has a molecular weight of 257.80 g/mol, XLogP of -0.39, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(Z)-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]azanium chloride is sourced from PubChem (CID 2750116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).