C21H21N3O4S2 — CID 27506090
N'-[(2R)-2-(4-methylphenyl)sulfonyl-2-thiophen-2-ylethyl]-N-(pyridin-4-ylmethyl)oxamide (PubChem CID 27506090) has the molecular formula C21H21N3O4S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is N'-[(2R)-2-(4-methylphenyl)sulfonyl-2-thiophen-2-ylethyl]-N-(pyridin-4-ylmethyl)oxamide.
| Compound Name | N'-[(2R)-2-(4-methylphenyl)sulfonyl-2-thiophen-2-ylethyl]-N-(pyridin-4-ylmethyl)oxamide |
|---|---|
| PubChem CID | 27506090 |
| Molecular Formula | C21H21N3O4S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | N'-[(2R)-2-(4-methylphenyl)sulfonyl-2-thiophen-2-ylethyl]-N-(pyridin-4-ylmethyl)oxamide |
| SMILES | Cc1ccc(S(=O)(=O)[C@H](CNC(=O)C(=O)NCc2ccncc2)c2cccs2)cc1 |
| InChI | InChI=1S/C21H21N3O4S2/c1-15-4-6-17(7-5-15)30(27,28)19(18-3-2-12-29-18)14-24-21(26)20(25)23-13-16-8-10-22-11-9-16/h2-12,19H,13-14H2,1H3,(H,23,25)(H,24,26)/t19-/m1/s1 |
| InChIKey | NRHACBXYWMFTGL-LJQANCHMSA-N |
| XLogP | 2.40 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|