C21H37NO2 — CID 2750730
N,1,2,2,3-pentamethyl-N-(1,2,2,3-tetramethylcyclopentanecarbonyl)cyclopentane-1-carboxamide (PubChem CID 2750730) has the molecular formula C21H37NO2 and a molecular weight of 335.53 g/mol. Its IUPAC name is N,1,2,2,3-pentamethyl-N-(1,2,2,3-tetramethylcyclopentanecarbonyl)cyclopentane-1-carboxamide.
| Compound Name | N,1,2,2,3-pentamethyl-N-(1,2,2,3-tetramethylcyclopentanecarbonyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 2750730 |
| Molecular Formula | C21H37NO2 |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 335.28 |
| IUPAC Name | N,1,2,2,3-pentamethyl-N-(1,2,2,3-tetramethylcyclopentanecarbonyl)cyclopentane-1-carboxamide |
| SMILES | CC1CCC(C)(C(=O)N(C)C(=O)C2(C)CCC(C)C2(C)C)C1(C)C |
| InChI | InChI=1S/C21H37NO2/c1-14-10-12-20(7,18(14,3)4)16(23)22(9)17(24)21(8)13-11-15(2)19(21,5)6/h14-15H,10-13H2,1-9H3 |
| InChIKey | BHUKNCSDHSSDAL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|