About 3-bromo-2,4-diphenyl-1,2-oxazol-5-one
3-bromo-2,4-diphenyl-1,2-oxazol-5-one (PubChem CID 2750874) has the molecular formula C15H10BrNO2
and a molecular weight of 316.15 g/mol. Its IUPAC name is 3-bromo-2,4-diphenyl-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 3-bromo-2,4-diphenyl-1,2-oxazol-5-one |
| PubChem CID | 2750874 |
| Molecular Formula | C15H10BrNO2 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 3-bromo-2,4-diphenyl-1,2-oxazol-5-one |
| SMILES | O=c1on(-c2ccccc2)c(Br)c1-c1ccccc1 |
| InChI | InChI=1S/C15H10BrNO2/c16-14-13(11-7-3-1-4-8-11)15(18)19-17(14)12-9-5-2-6-10-12/h1-10H |
| InChIKey | YIACTRJGUPUCCC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-2,4-diphenyl-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2,4-diphenyl-1,2-oxazol-5-one?
The IUPAC name of 3-bromo-2,4-diphenyl-1,2-oxazol-5-one (CID 2750874) is 3-bromo-2,4-diphenyl-1,2-oxazol-5-one.
What is the SMILES notation for 3-bromo-2,4-diphenyl-1,2-oxazol-5-one?
The canonical SMILES for 3-bromo-2,4-diphenyl-1,2-oxazol-5-one is O=c1on(-c2ccccc2)c(Br)c1-c1ccccc1.
What is the InChIKey of 3-bromo-2,4-diphenyl-1,2-oxazol-5-one?
The InChIKey is YIACTRJGUPUCCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrNO2/c16-14-13(11-7-3-1-4-8-11)15(18)19-17(14)12-9-5-2-6-10-12/h1-10H.
What are the key properties of 3-bromo-2,4-diphenyl-1,2-oxazol-5-one?
3-bromo-2,4-diphenyl-1,2-oxazol-5-one has a molecular weight of 316.15 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,4-diphenyl-1,2-oxazol-5-one is sourced from PubChem (CID 2750874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).