About 2,5-dithiophen-2-yl-1,3,4-thiadiazole
2,5-dithiophen-2-yl-1,3,4-thiadiazole (PubChem CID 2750959) has the molecular formula C10H6N2S3
and a molecular weight of 250.37 g/mol. Its IUPAC name is 2,5-dithiophen-2-yl-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2,5-dithiophen-2-yl-1,3,4-thiadiazole |
| PubChem CID | 2750959 |
| Molecular Formula | C10H6N2S3 |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | 2,5-dithiophen-2-yl-1,3,4-thiadiazole |
| SMILES | c1csc(-c2nnc(-c3cccs3)s2)c1 |
| InChI | InChI=1S/C10H6N2S3/c1-3-7(13-5-1)9-11-12-10(15-9)8-4-2-6-14-8/h1-6H |
| InChIKey | RMPQBSKBNKYOEW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,5-dithiophen-2-yl-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dithiophen-2-yl-1,3,4-thiadiazole?
The IUPAC name of 2,5-dithiophen-2-yl-1,3,4-thiadiazole (CID 2750959) is 2,5-dithiophen-2-yl-1,3,4-thiadiazole.
What is the SMILES notation for 2,5-dithiophen-2-yl-1,3,4-thiadiazole?
The canonical SMILES for 2,5-dithiophen-2-yl-1,3,4-thiadiazole is c1csc(-c2nnc(-c3cccs3)s2)c1.
What is the InChIKey of 2,5-dithiophen-2-yl-1,3,4-thiadiazole?
The InChIKey is RMPQBSKBNKYOEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2S3/c1-3-7(13-5-1)9-11-12-10(15-9)8-4-2-6-14-8/h1-6H.
What are the key properties of 2,5-dithiophen-2-yl-1,3,4-thiadiazole?
2,5-dithiophen-2-yl-1,3,4-thiadiazole has a molecular weight of 250.37 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dithiophen-2-yl-1,3,4-thiadiazole is sourced from PubChem (CID 2750959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).