About 3,5-dimethyl-[1,2]oxazolo[4,5-c]quinolin-4-one
3,5-dimethyl-[1,2]oxazolo[4,5-c]quinolin-4-one (PubChem CID 2750999) has the molecular formula C12H10N2O2
and a molecular weight of 214.22 g/mol. Its IUPAC name is 3,5-dimethyl-[1,2]oxazolo[4,5-c]quinolin-4-one.
Molecular Properties
| Compound Name | 3,5-dimethyl-[1,2]oxazolo[4,5-c]quinolin-4-one |
| PubChem CID | 2750999 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 3,5-dimethyl-[1,2]oxazolo[4,5-c]quinolin-4-one |
| SMILES | Cc1noc2c1c(=O)n(C)c1ccccc21 |
| InChI | InChI=1S/C12H10N2O2/c1-7-10-11(16-13-7)8-5-3-4-6-9(8)14(2)12(10)15/h3-6H,1-2H3 |
| InChIKey | LRLNEVZLVOHEOA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,5-dimethyl-[1,2]oxazolo[4,5-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-[1,2]oxazolo[4,5-c]quinolin-4-one?
The IUPAC name of 3,5-dimethyl-[1,2]oxazolo[4,5-c]quinolin-4-one (CID 2750999) is 3,5-dimethyl-[1,2]oxazolo[4,5-c]quinolin-4-one.
What is the SMILES notation for 3,5-dimethyl-[1,2]oxazolo[4,5-c]quinolin-4-one?
The canonical SMILES for 3,5-dimethyl-[1,2]oxazolo[4,5-c]quinolin-4-one is Cc1noc2c1c(=O)n(C)c1ccccc21.
What is the InChIKey of 3,5-dimethyl-[1,2]oxazolo[4,5-c]quinolin-4-one?
The InChIKey is LRLNEVZLVOHEOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2/c1-7-10-11(16-13-7)8-5-3-4-6-9(8)14(2)12(10)15/h3-6H,1-2H3.
What are the key properties of 3,5-dimethyl-[1,2]oxazolo[4,5-c]quinolin-4-one?
3,5-dimethyl-[1,2]oxazolo[4,5-c]quinolin-4-one has a molecular weight of 214.22 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-[1,2]oxazolo[4,5-c]quinolin-4-one is sourced from PubChem (CID 2750999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).