About 1H-indole-5-carbonitrile
1H-indole-5-carbonitrile (PubChem CID 27513) has the molecular formula C9H6N2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 1H-indole-5-carbonitrile.
Molecular Properties
| Compound Name | 1H-indole-5-carbonitrile |
| PubChem CID | 27513 |
| Molecular Formula | C9H6N2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | 1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C9H6N2/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-5,11H |
| InChIKey | YHYLDEVWYOFIJK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-indole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole-5-carbonitrile?
The IUPAC name of 1H-indole-5-carbonitrile (CID 27513) is 1H-indole-5-carbonitrile.
What is the SMILES notation for 1H-indole-5-carbonitrile?
The canonical SMILES for 1H-indole-5-carbonitrile is N#Cc1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole-5-carbonitrile?
The InChIKey is YHYLDEVWYOFIJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-5,11H.
What are the key properties of 1H-indole-5-carbonitrile?
1H-indole-5-carbonitrile has a molecular weight of 142.16 g/mol, XLogP of 2.04, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole-5-carbonitrile is sourced from PubChem (CID 27513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).