C23H19ClO2 — CID 2751460
15-chloro-4,7-dimethyl-7-phenyl-3,11-dioxatetracyclo[8.7.0.02,6.012,17]heptadeca-1(10),2(6),4,12(17),13,15-hexaene (PubChem CID 2751460) has the molecular formula C23H19ClO2 and a molecular weight of 362.86 g/mol. Its IUPAC name is 15-chloro-4,7-dimethyl-7-phenyl-3,11-dioxatetracyclo[8.7.0.02,6.012,17]heptadeca-1(10),2(6),4,12(17),13,15-hexaene.
| Compound Name | 15-chloro-4,7-dimethyl-7-phenyl-3,11-dioxatetracyclo[8.7.0.02,6.012,17]heptadeca-1(10),2(6),4,12(17),13,15-hexaene |
|---|---|
| PubChem CID | 2751460 |
| Molecular Formula | C23H19ClO2 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 15-chloro-4,7-dimethyl-7-phenyl-3,11-dioxatetracyclo[8.7.0.02,6.012,17]heptadeca-1(10),2(6),4,12(17),13,15-hexaene |
| SMILES | Cc1cc2c(o1)-c1c(oc3ccc(Cl)cc13)CCC2(C)c1ccccc1 |
| InChI | InChI=1S/C23H19ClO2/c1-14-12-18-22(25-14)21-17-13-16(24)8-9-19(17)26-20(21)10-11-23(18,2)15-6-4-3-5-7-15/h3-9,12-13H,10-11H2,1-2H3 |
| InChIKey | CGECLQBCSRMVSY-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |