C29H25F7NO2P — CID 2751575
4,4,5,5,6,6,6-heptafluoro-1-piperidin-1-yl-2-(triphenyl-lambda5-phosphanylidene)hexane-1,3-dione (PubChem CID 2751575) has the molecular formula C29H25F7NO2P and a molecular weight of 583.48 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluoro-1-piperidin-1-yl-2-(triphenyl-lambda5-phosphanylidene)hexane-1,3-dione.
| Compound Name | 4,4,5,5,6,6,6-heptafluoro-1-piperidin-1-yl-2-(triphenyl-lambda5-phosphanylidene)hexane-1,3-dione |
|---|---|
| PubChem CID | 2751575 |
| Molecular Formula | C29H25F7NO2P |
| Molecular Weight | 583.48 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluoro-1-piperidin-1-yl-2-(triphenyl-lambda5-phosphanylidene)hexane-1,3-dione |
| SMILES | O=C(C(C(=O)C(F)(F)C(F)(F)C(F)(F)F)=P(c1ccccc1)(c1ccccc1)c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C29H25F7NO2P/c30-27(31,28(32,33)29(34,35)36)25(38)24(26(39)37-19-11-4-12-20-37)40(21-13-5-1-6-14-21,22-15-7-2-8-16-22)23-17-9-3-10-18-23/h1-3,5-10,13-18H,4,11-12,19-20H2 |
| InChIKey | LMMKESTXRCLSNQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|