C25H26N2O2S — CID 2751697
4-[8-methoxy-4-(4-methoxyphenyl)-2,5-dihydro-1,5-benzothiazepin-2-yl]-N,N-dimethylaniline (PubChem CID 2751697) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is 4-[8-methoxy-4-(4-methoxyphenyl)-2,5-dihydro-1,5-benzothiazepin-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[8-methoxy-4-(4-methoxyphenyl)-2,5-dihydro-1,5-benzothiazepin-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 2751697 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 4-[8-methoxy-4-(4-methoxyphenyl)-2,5-dihydro-1,5-benzothiazepin-2-yl]-N,N-dimethylaniline |
| SMILES | COc1ccc(C2=CC(c3ccc(N(C)C)cc3)Sc3cc(OC)ccc3N2)cc1 |
| InChI | InChI=1S/C25H26N2O2S/c1-27(2)19-9-5-18(6-10-19)24-16-23(17-7-11-20(28-3)12-8-17)26-22-14-13-21(29-4)15-25(22)30-24/h5-16,24,26H,1-4H3 |
| InChIKey | RXQNMWIFHUHAEH-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|