C20H20O4 — CID 2751747
(4aS)-5,8-dihydroxy-1,2,4a-trimethyl-7-prop-2-enyl-4H-phenanthrene-3,6-dione (PubChem CID 2751747) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is (4aS)-5,8-dihydroxy-1,2,4a-trimethyl-7-prop-2-enyl-4H-phenanthrene-3,6-dione.
| Compound Name | (4aS)-5,8-dihydroxy-1,2,4a-trimethyl-7-prop-2-enyl-4H-phenanthrene-3,6-dione |
|---|---|
| PubChem CID | 2751747 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (4aS)-5,8-dihydroxy-1,2,4a-trimethyl-7-prop-2-enyl-4H-phenanthrene-3,6-dione |
| SMILES | C=CCC1=C(O)C2=CC=C3C(C)=C(C)C(=O)C[C@]3(C)C2=C(O)C1=O |
| InChI | InChI=1S/C20H20O4/c1-5-6-13-17(22)12-7-8-14-10(2)11(3)15(21)9-20(14,4)16(12)19(24)18(13)23/h5,7-8,22,24H,1,6,9H2,2-4H3/t20-/m0/s1 |
| InChIKey | FNEVHOUTQVOENX-FQEVSTJZSA-N |
| XLogP | 3.95 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|