C18H19N3S2 — CID 27518493
3-(benzylsulfanylmethyl)-4-[(1S)-1-phenylethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 27518493) has the molecular formula C18H19N3S2 and a molecular weight of 341.51 g/mol. Its IUPAC name is 3-(benzylsulfanylmethyl)-4-[(1S)-1-phenylethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(benzylsulfanylmethyl)-4-[(1S)-1-phenylethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 27518493 |
| Molecular Formula | C18H19N3S2 |
| Molecular Weight | 341.51 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 3-(benzylsulfanylmethyl)-4-[(1S)-1-phenylethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | C[C@@H](c1ccccc1)n1c(CSCc2ccccc2)n[nH]c1=S |
| InChI | InChI=1S/C18H19N3S2/c1-14(16-10-6-3-7-11-16)21-17(19-20-18(21)22)13-23-12-15-8-4-2-5-9-15/h2-11,14H,12-13H2,1H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | YVSVSHCBILHZFQ-AWEZNQCLSA-N |
| XLogP | 4.98 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|