About 10b,10c-dihydropyrene
10b,10c-dihydropyrene (PubChem CID 2751910) has the molecular formula C16H12
and a molecular weight of 204.27 g/mol. Its IUPAC name is 10b,10c-dihydropyrene.
Molecular Properties
| Compound Name | 10b,10c-dihydropyrene |
| PubChem CID | 2751910 |
| Molecular Formula | C16H12 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 10b,10c-dihydropyrene |
| SMILES | C1=CC2=CC=C3C=CC=C4C=CC(=C1)C2C43 |
| InChI | InChI=1S/C16H12/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h1-10,15-16H |
| InChIKey | RYEGJAKJRGZBAW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 10b,10c-dihydropyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10b,10c-dihydropyrene?
The IUPAC name of 10b,10c-dihydropyrene (CID 2751910) is 10b,10c-dihydropyrene.
What is the SMILES notation for 10b,10c-dihydropyrene?
The canonical SMILES for 10b,10c-dihydropyrene is C1=CC2=CC=C3C=CC=C4C=CC(=C1)C2C43.
What is the InChIKey of 10b,10c-dihydropyrene?
The InChIKey is RYEGJAKJRGZBAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h1-10,15-16H.
What are the key properties of 10b,10c-dihydropyrene?
10b,10c-dihydropyrene has a molecular weight of 204.27 g/mol, XLogP of 3.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 10b,10c-dihydropyrene is sourced from PubChem (CID 2751910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).