About 2,4-diamino-6-methylphenol
2,4-diamino-6-methylphenol (PubChem CID 27520) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 2,4-diamino-6-methylphenol.
Molecular Properties
| Compound Name | 2,4-diamino-6-methylphenol |
| PubChem CID | 27520 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 2,4-diamino-6-methylphenol |
| SMILES | Cc1cc(N)cc(N)c1O |
| InChI | InChI=1S/C7H10N2O/c1-4-2-5(8)3-6(9)7(4)10/h2-3,10H,8-9H2,1H3 |
| InChIKey | WSVFDPKNANXQKM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diamino-6-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diamino-6-methylphenol?
The IUPAC name of 2,4-diamino-6-methylphenol (CID 27520) is 2,4-diamino-6-methylphenol.
What is the SMILES notation for 2,4-diamino-6-methylphenol?
The canonical SMILES for 2,4-diamino-6-methylphenol is Cc1cc(N)cc(N)c1O.
What is the InChIKey of 2,4-diamino-6-methylphenol?
The InChIKey is WSVFDPKNANXQKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-4-2-5(8)3-6(9)7(4)10/h2-3,10H,8-9H2,1H3.
What are the key properties of 2,4-diamino-6-methylphenol?
2,4-diamino-6-methylphenol has a molecular weight of 138.17 g/mol, XLogP of 0.87, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diamino-6-methylphenol is sourced from PubChem (CID 27520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).