C19H24O10 — CID 2752086
[(1S,4S,10S,11S)-6-oxo-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9-oxatricyclo[5.3.1.04,11]undeca-2,7-dien-2-yl]methyl acetate (PubChem CID 2752086) has the molecular formula C19H24O10 and a molecular weight of 412.39 g/mol. Its IUPAC name is [(1S,4S,10S,11S)-6-oxo-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9-oxatricyclo[5.3.1.04,11]undeca-2,7-dien-2-yl]methyl acetate.
| Compound Name | [(1S,4S,10S,11S)-6-oxo-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9-oxatricyclo[5.3.1.04,11]undeca-2,7-dien-2-yl]methyl acetate |
|---|---|
| PubChem CID | 2752086 |
| Molecular Formula | C19H24O10 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | [(1S,4S,10S,11S)-6-oxo-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9-oxatricyclo[5.3.1.04,11]undeca-2,7-dien-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C[C@@H]2CC(=O)C3=CO[C@@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@H]1[C@@H]32 |
| InChI | InChI=1S/C19H24O10/c1-7(21)26-5-9-2-8-3-11(22)10-6-27-18(14(9)13(8)10)29-19-17(25)16(24)15(23)12(4-20)28-19/h2,6,8,12-20,23-25H,3-5H2,1H3/t8-,12-,13-,14-,15-,16+,17-,18+,19+/m1/s1 |
| InChIKey | WUDFNEXILUGTAV-VNSLNOFVSA-N |
| XLogP | -1.63 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|