C17H17Cl2N3O2S — CID 27522147
1-(2,4-dichlorophenyl)-3-[[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]urea (PubChem CID 27522147) has the molecular formula C17H17Cl2N3O2S and a molecular weight of 398.32 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]urea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]urea |
|---|---|
| PubChem CID | 27522147 |
| Molecular Formula | C17H17Cl2N3O2S |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]urea |
| SMILES | C[C@@H]1CCc2c(C(=O)NNC(=O)Nc3ccc(Cl)cc3Cl)csc2C1 |
| InChI | InChI=1S/C17H17Cl2N3O2S/c1-9-2-4-11-12(8-25-15(11)6-9)16(23)21-22-17(24)20-14-5-3-10(18)7-13(14)19/h3,5,7-9H,2,4,6H2,1H3,(H,21,23)(H2,20,22,24)/t9-/m1/s1 |
| InChIKey | DHUKQWSSTMDVDU-SECBINFHSA-N |
| XLogP | 4.65 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|