About 3-methylpentanal
3-methylpentanal (PubChem CID 27523) has the molecular formula C6H12O
and a molecular weight of 100.16 g/mol. Its IUPAC name is 3-methylpentanal.
Molecular Properties
| Compound Name | 3-methylpentanal |
| PubChem CID | 27523 |
| Molecular Formula | C6H12O |
| Molecular Weight | 100.16 g/mol |
| Exact Mass | 100.09 |
| IUPAC Name | 3-methylpentanal |
| SMILES | CCC(C)CC=O |
| InChI | InChI=1S/C6H12O/c1-3-6(2)4-5-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | YJWJGLQYQJGEEP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpentanal?
The IUPAC name of 3-methylpentanal (CID 27523) is 3-methylpentanal.
What is the SMILES notation for 3-methylpentanal?
The canonical SMILES for 3-methylpentanal is CCC(C)CC=O.
What is the InChIKey of 3-methylpentanal?
The InChIKey is YJWJGLQYQJGEEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O/c1-3-6(2)4-5-7/h5-6H,3-4H2,1-2H3.
What are the key properties of 3-methylpentanal?
3-methylpentanal has a molecular weight of 100.16 g/mol, XLogP of 1.62, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpentanal is sourced from PubChem (CID 27523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).