About 3,4-diphenylpyrrole-2,5-dione
3,4-diphenylpyrrole-2,5-dione (PubChem CID 2752461) has the molecular formula C16H11NO2
and a molecular weight of 249.27 g/mol. Its IUPAC name is 3,4-diphenylpyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3,4-diphenylpyrrole-2,5-dione |
| PubChem CID | 2752461 |
| Molecular Formula | C16H11NO2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 3,4-diphenylpyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C16H11NO2/c18-15-13(11-7-3-1-4-8-11)14(16(19)17-15)12-9-5-2-6-10-12/h1-10H,(H,17,18,19) |
| InChIKey | WADCPEMKIBAJHH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diphenylpyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diphenylpyrrole-2,5-dione?
The IUPAC name of 3,4-diphenylpyrrole-2,5-dione (CID 2752461) is 3,4-diphenylpyrrole-2,5-dione.
What is the SMILES notation for 3,4-diphenylpyrrole-2,5-dione?
The canonical SMILES for 3,4-diphenylpyrrole-2,5-dione is O=C1NC(=O)C(c2ccccc2)=C1c1ccccc1.
What is the InChIKey of 3,4-diphenylpyrrole-2,5-dione?
The InChIKey is WADCPEMKIBAJHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO2/c18-15-13(11-7-3-1-4-8-11)14(16(19)17-15)12-9-5-2-6-10-12/h1-10H,(H,17,18,19).
What are the key properties of 3,4-diphenylpyrrole-2,5-dione?
3,4-diphenylpyrrole-2,5-dione has a molecular weight of 249.27 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diphenylpyrrole-2,5-dione is sourced from PubChem (CID 2752461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).