C19H19N3O6S — CID 27525315
trans-(1S,2S)-2-[[3-[(3-nitrophenyl)carbamoyl]thiophen-2-yl]carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 27525315) has the molecular formula C19H19N3O6S and a molecular weight of 417.44 g/mol. Its IUPAC name is trans-(1S,2S)-2-[[3-[(3-nitrophenyl)carbamoyl]thiophen-2-yl]carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1S,2S)-2-[[3-[(3-nitrophenyl)carbamoyl]thiophen-2-yl]carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 27525315 |
| Molecular Formula | C19H19N3O6S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | trans-(1S,2S)-2-[[3-[(3-nitrophenyl)carbamoyl]thiophen-2-yl]carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)c1ccsc1NC(=O)[C@H]1CCCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C19H19N3O6S/c23-16(13-6-1-2-7-14(13)19(25)26)21-18-15(8-9-29-18)17(24)20-11-4-3-5-12(10-11)22(27)28/h3-5,8-10,13-14H,1-2,6-7H2,(H,20,24)(H,21,23)(H,25,26)/t13-,14-/m0/s1 |
| InChIKey | ZNSXYHNSJYECDB-KBPBESRZSA-N |
| XLogP | 3.74 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|