About 2-methyl-N-(2-methyl-9,10-dioxoanthracen-1-yl)propanamide
2-methyl-N-(2-methyl-9,10-dioxoanthracen-1-yl)propanamide (PubChem CID 2752532) has the molecular formula C19H17NO3
and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-methyl-N-(2-methyl-9,10-dioxoanthracen-1-yl)propanamide.
Molecular Properties
| Compound Name | 2-methyl-N-(2-methyl-9,10-dioxoanthracen-1-yl)propanamide |
| PubChem CID | 2752532 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-methyl-N-(2-methyl-9,10-dioxoanthracen-1-yl)propanamide |
| SMILES | Cc1ccc2c(c1NC(=O)C(C)C)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H17NO3/c1-10(2)19(23)20-16-11(3)8-9-14-15(16)18(22)13-7-5-4-6-12(13)17(14)21/h4-10H,1-3H3,(H,20,23) |
| InChIKey | GPUXFMDYVQPKEV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-(2-methyl-9,10-dioxoanthracen-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(2-methyl-9,10-dioxoanthracen-1-yl)propanamide?
The IUPAC name of 2-methyl-N-(2-methyl-9,10-dioxoanthracen-1-yl)propanamide (CID 2752532) is 2-methyl-N-(2-methyl-9,10-dioxoanthracen-1-yl)propanamide.
What is the SMILES notation for 2-methyl-N-(2-methyl-9,10-dioxoanthracen-1-yl)propanamide?
The canonical SMILES for 2-methyl-N-(2-methyl-9,10-dioxoanthracen-1-yl)propanamide is Cc1ccc2c(c1NC(=O)C(C)C)C(=O)c1ccccc1C2=O.
What is the InChIKey of 2-methyl-N-(2-methyl-9,10-dioxoanthracen-1-yl)propanamide?
The InChIKey is GPUXFMDYVQPKEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO3/c1-10(2)19(23)20-16-11(3)8-9-14-15(16)18(22)13-7-5-4-6-12(13)17(14)21/h4-10H,1-3H3,(H,20,23).
What are the key properties of 2-methyl-N-(2-methyl-9,10-dioxoanthracen-1-yl)propanamide?
2-methyl-N-(2-methyl-9,10-dioxoanthracen-1-yl)propanamide has a molecular weight of 307.35 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(2-methyl-9,10-dioxoanthracen-1-yl)propanamide is sourced from PubChem (CID 2752532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).