C26H25F3NO2P — CID 2752548
N,N-diethyl-4,4,4-trifluoro-3-oxo-2-(triphenyl-lambda5-phosphanylidene)butanamide (PubChem CID 2752548) has the molecular formula C26H25F3NO2P and a molecular weight of 471.46 g/mol. Its IUPAC name is N,N-diethyl-4,4,4-trifluoro-3-oxo-2-(triphenyl-lambda5-phosphanylidene)butanamide.
| Compound Name | N,N-diethyl-4,4,4-trifluoro-3-oxo-2-(triphenyl-lambda5-phosphanylidene)butanamide |
|---|---|
| PubChem CID | 2752548 |
| Molecular Formula | C26H25F3NO2P |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N,N-diethyl-4,4,4-trifluoro-3-oxo-2-(triphenyl-lambda5-phosphanylidene)butanamide |
| SMILES | CCN(CC)C(=O)C(C(=O)C(F)(F)F)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H25F3NO2P/c1-3-30(4-2)25(32)23(24(31)26(27,28)29)33(20-14-8-5-9-15-20,21-16-10-6-11-17-21)22-18-12-7-13-19-22/h5-19H,3-4H2,1-2H3 |
| InChIKey | CLNFQJNTYLEDEK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|