C8H4Cl2O3 — CID 2752586
5,6-dichloro-3-hydroxy-3H-2-benzofuran-1-one (PubChem CID 2752586) has the molecular formula C8H4Cl2O3 and a molecular weight of 219.02 g/mol. Its IUPAC name is 5,6-dichloro-3-hydroxy-3H-2-benzofuran-1-one.
| Compound Name | 5,6-dichloro-3-hydroxy-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 2752586 |
| Molecular Formula | C8H4Cl2O3 |
| Molecular Weight | 219.02 g/mol |
| Exact Mass | 217.95 |
| IUPAC Name | 5,6-dichloro-3-hydroxy-3H-2-benzofuran-1-one |
| SMILES | O=C1OC(O)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C8H4Cl2O3/c9-5-1-3-4(2-6(5)10)8(12)13-7(3)11/h1-2,7,11H |
| InChIKey | AYZIELGHYOUWQP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.02 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |