About trimethyl-[6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium
trimethyl-[6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium (PubChem CID 2752664) has the molecular formula C16H32N2+2
and a molecular weight of 252.45 g/mol. Its IUPAC name is trimethyl-[6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium.
Molecular Properties
| Compound Name | trimethyl-[6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium |
| PubChem CID | 2752664 |
| Molecular Formula | C16H32N2+2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | trimethyl-[6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium |
| SMILES | C[N+](C)(C)C1CC=CCC([N+](C)(C)C)CC=CC1 |
| InChI | InChI=1S/C16H32N2/c1-17(2,3)15-11-7-9-13-16(18(4,5)6)14-10-8-12-15/h7-10,15-16H,11-14H2,1-6H3/q+2 |
| InChIKey | PFUNJILHKCCBIC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium?
The IUPAC name of trimethyl-[6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium (CID 2752664) is trimethyl-[6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium.
What is the SMILES notation for trimethyl-[6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium?
The canonical SMILES for trimethyl-[6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium is C[N+](C)(C)C1CC=CCC([N+](C)(C)C)CC=CC1.
What is the InChIKey of trimethyl-[6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium?
The InChIKey is PFUNJILHKCCBIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2/c1-17(2,3)15-11-7-9-13-16(18(4,5)6)14-10-8-12-15/h7-10,15-16H,11-14H2,1-6H3/q+2.
What are the key properties of trimethyl-[6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium?
trimethyl-[6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium has a molecular weight of 252.45 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[6-(trimethylazaniumyl)cyclodeca-3,8-dien-1-yl]azanium is sourced from PubChem (CID 2752664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).