C15H12N4O — CID 2752894
(1S,8S)-9-oxatricyclo[6.2.2.02,7]dodec-2(7)-ene-11,11,12,12-tetracarbonitrile (PubChem CID 2752894) has the molecular formula C15H12N4O and a molecular weight of 264.29 g/mol. Its IUPAC name is (1S,8S)-9-oxatricyclo[6.2.2.02,7]dodec-2(7)-ene-11,11,12,12-tetracarbonitrile.
| Compound Name | (1S,8S)-9-oxatricyclo[6.2.2.02,7]dodec-2(7)-ene-11,11,12,12-tetracarbonitrile |
|---|---|
| PubChem CID | 2752894 |
| Molecular Formula | C15H12N4O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (1S,8S)-9-oxatricyclo[6.2.2.02,7]dodec-2(7)-ene-11,11,12,12-tetracarbonitrile |
| SMILES | N#CC1(C#N)[C@H]2CO[C@@H](C3=C2CCCC3)C1(C#N)C#N |
| InChI | InChI=1S/C15H12N4O/c16-6-14(7-17)12-5-20-13(15(14,8-18)9-19)11-4-2-1-3-10(11)12/h12-13H,1-5H2/t12-,13-/m0/s1 |
| InChIKey | ILYQRMBSDJJOKK-STQMWFEESA-N |
| XLogP | 1.95 |
| TPSA | 104.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|