About spiro[1,4-dihydroisochromene-3,1'-cyclohexane]-1-ol
spiro[1,4-dihydroisochromene-3,1'-cyclohexane]-1-ol (PubChem CID 2752895) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is spiro[1,4-dihydroisochromene-3,1'-cyclohexane]-1-ol.
Molecular Properties
| Compound Name | spiro[1,4-dihydroisochromene-3,1'-cyclohexane]-1-ol |
| PubChem CID | 2752895 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | spiro[1,4-dihydroisochromene-3,1'-cyclohexane]-1-ol |
| SMILES | OC1OC2(CCCCC2)Cc2ccccc21 |
| InChI | InChI=1S/C14H18O2/c15-13-12-7-3-2-6-11(12)10-14(16-13)8-4-1-5-9-14/h2-3,6-7,13,15H,1,4-5,8-10H2 |
| InChIKey | PWDBZPQTBQPPQZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[1,4-dihydroisochromene-3,1'-cyclohexane]-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,4-dihydroisochromene-3,1'-cyclohexane]-1-ol?
The IUPAC name of spiro[1,4-dihydroisochromene-3,1'-cyclohexane]-1-ol (CID 2752895) is spiro[1,4-dihydroisochromene-3,1'-cyclohexane]-1-ol.
What is the SMILES notation for spiro[1,4-dihydroisochromene-3,1'-cyclohexane]-1-ol?
The canonical SMILES for spiro[1,4-dihydroisochromene-3,1'-cyclohexane]-1-ol is OC1OC2(CCCCC2)Cc2ccccc21.
What is the InChIKey of spiro[1,4-dihydroisochromene-3,1'-cyclohexane]-1-ol?
The InChIKey is PWDBZPQTBQPPQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2/c15-13-12-7-3-2-6-11(12)10-14(16-13)8-4-1-5-9-14/h2-3,6-7,13,15H,1,4-5,8-10H2.
What are the key properties of spiro[1,4-dihydroisochromene-3,1'-cyclohexane]-1-ol?
spiro[1,4-dihydroisochromene-3,1'-cyclohexane]-1-ol has a molecular weight of 218.30 g/mol, XLogP of 2.95, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,4-dihydroisochromene-3,1'-cyclohexane]-1-ol is sourced from PubChem (CID 2752895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).