C12H8F6O4 — CID 2752900
[2,5-dimethyl-4-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate (PubChem CID 2752900) has the molecular formula C12H8F6O4 and a molecular weight of 330.18 g/mol. Its IUPAC name is [2,5-dimethyl-4-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2,5-dimethyl-4-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 2752900 |
| Molecular Formula | C12H8F6O4 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | [2,5-dimethyl-4-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1cc(OC(=O)C(F)(F)F)c(C)cc1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H8F6O4/c1-5-3-8(22-10(20)12(16,17)18)6(2)4-7(5)21-9(19)11(13,14)15/h3-4H,1-2H3 |
| InChIKey | RSZWJRJXFBGCIV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|