About tricyclo[6.2.0.03,6]deca-1(8),3(6)-diene
tricyclo[6.2.0.03,6]deca-1(8),3(6)-diene (PubChem CID 2752902) has the molecular formula C10H12
and a molecular weight of 132.21 g/mol. Its IUPAC name is tricyclo[6.2.0.03,6]deca-1(8),3(6)-diene.
Molecular Properties
| Compound Name | tricyclo[6.2.0.03,6]deca-1(8),3(6)-diene |
| PubChem CID | 2752902 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | tricyclo[6.2.0.03,6]deca-1(8),3(6)-diene |
| SMILES | C1CC2=C1CC1=C(CC1)C2 |
| InChI | InChI=1S/C10H12/c1-2-8-6-10-4-3-9(10)5-7(1)8/h1-6H2 |
| InChIKey | CDFSMHKHGXCGNB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tricyclo[6.2.0.03,6]deca-1(8),3(6)-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[6.2.0.03,6]deca-1(8),3(6)-diene?
The IUPAC name of tricyclo[6.2.0.03,6]deca-1(8),3(6)-diene (CID 2752902) is tricyclo[6.2.0.03,6]deca-1(8),3(6)-diene.
What is the SMILES notation for tricyclo[6.2.0.03,6]deca-1(8),3(6)-diene?
The canonical SMILES for tricyclo[6.2.0.03,6]deca-1(8),3(6)-diene is C1CC2=C1CC1=C(CC1)C2.
What is the InChIKey of tricyclo[6.2.0.03,6]deca-1(8),3(6)-diene?
The InChIKey is CDFSMHKHGXCGNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12/c1-2-8-6-10-4-3-9(10)5-7(1)8/h1-6H2.
What are the key properties of tricyclo[6.2.0.03,6]deca-1(8),3(6)-diene?
tricyclo[6.2.0.03,6]deca-1(8),3(6)-diene has a molecular weight of 132.21 g/mol, XLogP of 2.96, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[6.2.0.03,6]deca-1(8),3(6)-diene is sourced from PubChem (CID 2752902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).