C18H12Cl2O4 — CID 2752955
2,3-dichloro-1,4-dihydroxy-5a,6,11,11a-tetrahydrotetracene-5,12-dione (PubChem CID 2752955) has the molecular formula C18H12Cl2O4 and a molecular weight of 363.20 g/mol. Its IUPAC name is 2,3-dichloro-1,4-dihydroxy-5a,6,11,11a-tetrahydrotetracene-5,12-dione.
| Compound Name | 2,3-dichloro-1,4-dihydroxy-5a,6,11,11a-tetrahydrotetracene-5,12-dione |
|---|---|
| PubChem CID | 2752955 |
| Molecular Formula | C18H12Cl2O4 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 2,3-dichloro-1,4-dihydroxy-5a,6,11,11a-tetrahydrotetracene-5,12-dione |
| SMILES | O=C1c2c(O)c(Cl)c(Cl)c(O)c2C(=O)C2Cc3ccccc3CC12 |
| InChI | InChI=1S/C18H12Cl2O4/c19-13-14(20)18(24)12-11(17(13)23)15(21)9-5-7-3-1-2-4-8(7)6-10(9)16(12)22/h1-4,9-10,23-24H,5-6H2 |
| InChIKey | AWHCYSWQJIHNOH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|