C10H12O2 — CID 2752996
(1S,2S,6S,7S)-tricyclo[5.3.0.02,6]decane-3,10-dione (PubChem CID 2752996) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (1S,2S,6S,7S)-tricyclo[5.3.0.02,6]decane-3,10-dione.
| Compound Name | (1S,2S,6S,7S)-tricyclo[5.3.0.02,6]decane-3,10-dione |
|---|---|
| PubChem CID | 2752996 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (1S,2S,6S,7S)-tricyclo[5.3.0.02,6]decane-3,10-dione |
| SMILES | O=C1CC[C@H]2[C@@H]3CCC(=O)[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C10H12O2/c11-7-3-1-5-6-2-4-8(12)10(6)9(5)7/h5-6,9-10H,1-4H2/t5-,6-,9+,10+/m0/s1 |
| InChIKey | QSFVWIHVZNPWID-DWAQLAQLSA-N |
| XLogP | 1.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |